Molecular Analysis
ПродвинутыйdataМинимальный контекст: 64K
Performs cheminformatics and molecular property analysis using RDKit, PubChem, and ChEMBL. Supports SMILES/InChI parsing, molecular descriptor calculation, drug-likeness filtering (Lipinski, Veber), ADMET prediction, substructure search, and structure-activity relationship (SAR) analysis for drug discovery workflows.
Варианты использования
- Calculating molecular descriptors and drug-likeness properties
- Virtual screening of compound libraries against target profiles
- Structure-activity relationship analysis for lead optimization
- ADMET property prediction for drug candidates
- Querying PubChem and ChEMBL for bioactivity data
- Generating molecular fingerprints for similarity search
Пример промпта
Analyze the following set of SMILES strings for drug-likeness and ADMET properties. Compounds: - CC(=O)Oc1ccccc1C(=O)O (Aspirin) - CC12CCC3C(C1CCC2O)CCC4=CC(=O)CCC34C (Testosterone) - CN1C=NC2=C1C(=O)N(C(=O)N2C)C (Caffeine) For each compound: 1. Calculate Lipinski Rule of 5 properties (MW, LogP, HBD, HBA) 2. Assess Veber rules (TPSA, rotatable bonds) 3. Predict basic ADMET flags (solubility, BBB permeability) 4. Generate RDKit Python code for the full analysis pipeline 5. Rank compounds by overall drug-likeness score Output a summary table and the complete Python script using RDKit.
Рекомендуемые модели
Совместимые инструменты
claude-codecursorkiroany
Модальности
Вход: text, code, file
→Выход: text, code
Похожие Skills
Автор
OpenModels Community